![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/layout.gif) | 2.19 Tapani Patch.pdf | 2024-02-28 21:35 | 2.0M | |
| 9CF Thread.pdf | 2024-02-28 21:35 | 212K | |
| 9394 for 0102.pdf | 2024-02-28 21:35 | 42M | |
| 9798 Update.pdf | 2024-02-28 21:35 | 2.7M | |
| AI Tactics (How to Convert).pdf | 2024-02-28 21:35 | 3.1M | |
| Add Fonts to your Game.pdf | 2024-02-28 21:35 | 7.9M | |
| Adding space to an exe.pdf | 2024-02-28 21:35 | 396K | |
| All New - All Time Records.pdf | 2024-02-28 21:36 | 111M | |
| Applying for Jobs Abroad.pdf | 2024-02-28 21:35 | 23M | |
| A quick post on Idle Sensitivity.pdf | 2024-02-28 21:35 | 1.2M | |
| Benchmarking.pdf | 2024-02-28 21:35 | 438K | |
| CM0001 Discussion.pdf | 2024-02-28 21:36 | 158M | |
| CM 0102 10 years of work and editing.pdf | 2024-02-28 21:36 | 17M | |
| CM0102 Editor Help Notes.pdf | 2024-02-28 21:36 | 217K | |
| CM0102 Updater (a DB Pre-Game Editor).pdf | 2024-02-28 21:36 | 6.0M | |
| CM0102 in a Web Browser.pdf | 2024-02-28 21:36 | 324K | |
| CM2 Downloads.pdf | 2024-02-28 21:36 | 4.1M | |
| CM3 (9899) Original data set.pdf | 2024-02-28 21:36 | 1.4M | |
| CM 3 - Downloads.pdf | 2024-02-28 21:36 | 1.2M | |
| CM3 Project by Cam F.pdf | 2024-02-28 21:36 | 2.7M | |
| CM 8990 project - in progress.pdf | 2024-02-28 21:36 | 14M | |
| CMRTE Real Time Editor Alpha.pdf | 2024-02-28 21:36 | 616K | |
| CMScout Intrinsic.pdf | 2024-02-28 21:36 | 2.1M | |
| CM Secrets.pdf | 2024-02-28 21:36 | 760K | |
| Change Start Date Year.pdf | 2024-02-28 21:35 | 4.5M | |
| Changing World Cup Qualifiers.pdf | 2024-02-28 21:35 | 224K | |
| Club Competition Histories 2020.pdf | 2024-02-28 21:35 | 435K | |
| Coloured Attributes.pdf | 2024-02-28 21:36 | 366K | |
| Competition or Club Renaming.pdf | 2024-02-28 21:36 | 1.4M | |
| Confederations Cup stops happening.pdf | 2024-02-28 21:36 | 1.2M | |
| Database Structure.pdf | 2024-02-28 21:36 | 373K | |
| Everything there is to know about training - by The Eejit.pdf | 2024-02-28 21:36 | 5.1M | |
| Financial Queries.pdf | 2024-02-28 21:36 | 15M | |
| Flex 2 - JLCollection - JLPatch Queries.pdf | 2024-02-28 21:36 | 14M | |
| French Competition Issues.pdf | 2024-02-28 21:36 | 1.3M | |
| Frustrations with CM 0102.pdf | 2024-02-28 21:36 | 8.1M | |
| Game Crashing issue.pdf | 2024-02-28 21:37 | 8.7M | |
| General Patch Queries.pdf | 2024-02-28 21:37 | 11M | |
| Good Players - Original Game.pdf | 2024-02-28 21:37 | 23M | |
| Harder AI Tactics.pdf | 2024-02-28 21:37 | 4.4M | |
| How to build a top tactic.pdf | 2024-02-28 21:37 | 2.0M | |
| Increase in Red Cards since ODB.pdf | 2024-02-28 21:37 | 3.3M | |
| Insert CD - No Disc Queries (RIGHT-CLICK CM0102.ISO AND CLICK MOUNT).pdf | 2024-02-28 21:35 | 18M | |
| Italian League Structure.pdf | 2024-02-28 21:37 | 6.0M | |
| Java Programming Thread.pdf | 2024-02-28 21:37 | 489K | |
| John Locke Explains.pdf | 2024-02-28 21:37 | 408K | |
| Key Attributes.pdf | 2024-02-28 21:37 | 7.8M | |
| League Patches.pdf | 2024-02-28 21:38 | 141M | |
| League or Cup Structure Queries.pdf | 2024-02-28 21:37 | 12M | |
| League replacement patch issues.pdf | 2024-02-28 21:37 | 2.4M | |
| Load Players Out.pdf | 2024-02-28 21:37 | 412K | |
| MAC Problems and Queries (SOLUTIONS TO PLAY ON MAC POSTED HERE).pdf | 2024-02-28 21:37 | 17M | |
| Making the game harder.pdf | 2024-02-28 21:37 | 3.6M | |
| Messed up Editing the Database.pdf | 2024-02-28 21:37 | 2.5M | |
| Names Editor Queries.pdf | 2024-02-28 21:37 | 1.1M | |
| Natural Born Freaks.pdf | 2024-02-28 21:37 | 26M | |
| Network Game Queries.pdf | 2024-02-28 21:37 | 8.4M | |
| Network game problems with saturns patches.pdf | 2024-02-28 21:37 | 2.1M | |
| New regen code in 2.21.pdf | 2024-02-28 21:37 | 236K | |
| Nicks CM0102Patcher (New Rip).pdf | 2024-02-28 21:38 | 83M | |
| Nicks CM0102Patcher.pdf | 2024-02-28 21:38 | 31M | |
| October 2019 Data Update Technical Support.pdf | 2024-02-28 21:38 | 13M | |
| Offsets (New Rip).pdf | 2024-02-28 21:39 | 115M | |
| Offsets Thread (Printable).pdf | 2024-02-28 21:38 | 12M | |
| Offsets Thread.pdf | 2024-02-28 21:38 | 27M | |
| Open Tactic League (new thread).pdf | 2024-02-28 21:38 | 24M | |
| Patch 2.21.1 Plus.pdf | 2024-02-28 21:39 | 1.1M | |
| Patch 2.21.1 Plus v2.pdf | 2024-02-28 21:39 | 2.7M | |
| Patch 2.21.1 Plus v3.pdf | 2024-02-28 21:39 | 4.1M | |
| Patch 2.21.pdf | 2024-02-28 21:39 | 9.0M | |
| Patch v4.pdf | 2024-02-28 21:39 | 6.5M | |
| Patch v5.pdf | 2024-02-28 21:39 | 5.3M | |
| Patch v6.pdf | 2024-02-28 21:39 | 5.1M | |
| Patch v7 (v8 in Post 377).pdf | 2024-02-28 21:39 | 5.8M | |
| Patch v8.pdf | 2024-02-28 21:39 | 6.7M | |
| Patch v9.pdf | 2024-02-28 21:39 | 5.5M | |
| Player restrictions (non-eu foreigners).pdf | 2024-02-28 21:39 | 2.0M | |
| Problem changing Norway to Uruguay.pdf | 2024-02-28 21:39 | 511K | |
| Project 369.pdf | 2024-02-28 21:39 | 1.7M | |
| Pundit-file.pdf | 2024-02-28 21:39 | 6.4M | |
| Questions and Comments that Dont Warrant a Thread.pdf | 2024-02-28 21:39 | 118M | |
| Reserve Teams.pdf | 2024-02-28 21:39 | 2.4M | |
| Resetting regens (Printable).pdf | 2024-02-28 21:39 | 535K | |
| Resetting regens.pdf | 2024-02-28 21:39 | 1.1M | |
| Saturn v6 Beta.pdf | 2024-02-28 21:39 | 1.5M | |
| Save Game Queries.pdf | 2024-02-28 21:39 | 41M | |
| Second Nationalities and Foreigner Restrictions.pdf | 2024-02-28 21:39 | 1.5M | |
| Stadium Queries.pdf | 2024-02-28 21:39 | 3.2M | |
| Starting in 2015 (aka the Euro 2000 qualifying bug).pdf | 2024-02-28 21:39 | 2.3M | |
| Tactics - Help and Discussion.pdf | 2024-02-28 21:40 | 18M | |
| Tactics - Non WIBWOB - How does yours look like.pdf | 2024-02-28 21:40 | 54M | |
| Tactics - WibWob - How does yours look like.pdf | 2024-02-28 21:40 | 7.9M | |
| Tapanis change in player development after v2.17 patch.pdf | 2024-02-28 21:40 | 621K | |
| The 9CF Thread.pdf | 2024-02-28 21:40 | 1.2M | |
| The Alternative Tactic League.pdf | 2024-02-28 21:40 | 37M | |
| Training - Attributes Decreasing.pdf | 2024-02-28 21:40 | 3.8M | |
| Training - New Position.pdf | 2024-02-28 21:40 | 4.7M | |
| Training Routines.pdf | 2024-02-28 21:40 | 2.9M | |
| Training and Finances - An Alternative Guide.pdf | 2024-02-28 21:40 | 2.3M | |
| Transfer Tool - An open source program to add and edit players using spreadsheets.pdf | 2024-02-28 21:40 | 3.7M | |
| Transfer Window (Printable).pdf | 2024-02-28 21:40 | 710K | |
| Transfer Window.pdf | 2024-02-28 21:40 | 6.5M | |
| Tsigalko vs van Nistelrooy Thread.pdf | 2024-02-28 21:40 | 32M | |
| Tutorial - Changing League Structures.pdf | 2024-02-28 21:40 | 396K | |
| Tutorial - New League Replacement Guide.pdf | 2024-02-28 21:40 | 619K | |
| Tutorial - Using OllyDbg to patch your CM .exe.pdf | 2024-02-28 21:40 | 3.3M | |
| Using Development Benchmark Mode.pdf | 2024-02-28 21:40 | 2.6M | |
| VAR come to CM0102.pdf | 2024-02-28 21:40 | 1.7M | |
| What a Data Update changes.pdf | 2024-02-28 21:40 | 756K | |
| What is CA15.pdf | 2024-02-28 21:40 | 3.0M | |
![[ ]](/icons/compressed.gif) | Xenos_Old_Thread_Archive.zip | 2024-02-28 21:41 | 128M | |
![[ ]](/icons/unknown.gif) | download.js | 2024-02-28 21:36 | 1.7K | |
| saturns Patch Queries.pdf | 2024-02-28 21:39 | 11M | |
|
|---|